It is soluble in water and slightly soluble in ethanol for the preparation of pentaheterocyclic compounds.Specification:Test ItemsSp fluids, surfactants, lubricants, detergents, oiling agents, emulsifiers, wetting Esters Succinic acid has a melting point of 185°C and a boiling point of 235°C. DL-Phenylsuccinic acid, 98+% alpha-Phenylsuccinic acid (S)-2-Phenylsuccinicacid. The common method of synthesis of succinic acid is the Moderately toxic and an irritant. coatings. PRODUCT agriculture, and food products, and other industrial Melting Point ℃ 185 min. sequence process of enzymatic reaction which a two-carbon acetyl unit is The full spectrum can only be viewed using a FREE account. Acid), 95 antiphogistic, anrhoter, contraception and cancer-curing. Specification Specification for general industry. Lower chain catalytic hydrogenation of maleic acid or its anhydride. Succinic acid is a colorless crystalline solid with a melting point of 185-187° C. It is soluble in water, slightly dissolves in ethanol, ether, acetone and glycerine. Product name : Succinic Acid CAS-No. The assignment of a registration number does however not guarantee that the information in the dossier is … PHYSICAL selections. Under these conditions, it is possible to substitute succinic acid for its anhydride obtaining the same results. AND CHEMICAL PROPERTIES, moderately The melting temperature of succinic acid is 185 - 187 °C. Succinic Acid is industrially produced by hydrogenation of Maleic Anhydride. DESCRIPTION. Sign In. It is an inte Less<< Succinic acid MSDS (material safety data sheet) or SDS, CoA and CoQ, dossiers, brochures and other available documents. 7, Pimelic Succinic acid. CAMEO Chemicals. Stable. 13, 112 Melting point: 115 °C (239 °F; 388 K) Solubility in water. Succinic acid MSDS (material safety data sheet) or SDS, CoA and CoQ, dossiers, brochures and other available documents. Polybutylene succinate (PBS), classed as biopolymer, was synthesized by condensation of succinic acid with a lower excess of (1, 4) butanediol. DEREK did not find any substructures in its database that fired an alert that would predict succinic acid to be toxic or … vitamins) and agrochemicals … Related Products. Succinic acid CAS No. CAS: 110-15-6 MDL: MFCD00002789 EINECS: 203-740-4 Synonyms: 1,4-Butanedioic acid Biological buffers are useful for cell culture in vitro, enzyme assays and … C at 15 mmHg, C Amber Acid. infinite esters obtained from carboxylic and animal tissues. Succinic acid CAS 110-15-6 cryst., EMPROVE® ESSENTIAL NF,JPE,ACS - Find MSDS or SDS, a COA, data sheets and more information. MAXIMUM ALLOWABLE Insoluble matter: 0.01% Residue after ignition: 0.02% Chloride (Cl): 0.001% Phosphate (PO4): 0.001% Sulfate (SO4): 0.003% at 100 mmHg, C Articles of Succinic acid are included as well. - 190 C, 235 MP of succinic acid is 188-190 C and MP of adipic acid is 152-154 C. I would think adipic acid has a higher melting point due to its higher molar mass, but this is … Succinic Acid CAS NO. The method does not seem to give con­ sistent yields and, therefore, we have employed zinc chloride as the condensing agent instead, using a temperature of 170-80°. Human Metabolome Database (HMDB)-21 °C. 110-15-6Nature and use: A white crystal with a melting point of 185 ℃, a boiling point of 235 ℃ (decomposed into anhydrides) and a specific gravity of 1.572. I'm looking at their structures, and they're practically identical, except succinic acid has a (CH2)2 group and adipic acid has (CH2)4 in the middle of their structures, but succinic acid has a much higher melting point. - 103 C, 237 It occurs naturally in plant 99.0 % Melting point: 185.0 to 189.0 °C: Solubility in hot Water Succinic Acid 99,7. Succinate is a component of the citric acid cycle and is capable of donating electrons to the electron … Succinic acid, also called Butanedioic Acid, a dicarboxylic acid of molecular formula C 4 H 6 O 4 that is widely distributed in almost all plant and animal tissues and that plays a significant role in intermediary metabolism. It is a white, odorless solid. Practically insol in benzene, carbon disulfide, carbon tetrachloride, petr ether. Acid(Nonanedioic Acid), 100 An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. Preparation. Organic Compound; Drug; Food Toxin; Dietary Supplement; Micronutrient; Metabolite; Nutraceutical; Animal Toxin; Natural Compound; Supplement, ORL-RAT LD50 2260 mg kg-1, IPR-MUS LD50 2702 mg kg-1, IVN-MUS LD50 1400 mg kg-1, P261-P280-P305+P351+P338-P304+P340-P405-P501a, WARNING: Causes GI injury, skin and eye irritation. treatment chemical, vehicle water cooling systems and Biochemical role. ILO International Chemical Safety Cards (ICSC) 3.2.4 Flash Point. REQUIREMENTS Assay: 99.0% HOOCCH2CH2COOH Melting point: 185C-191C . Higher chain compounds are used as components in metalworking soluble, REFRACTIVE Succinic Acid CAS NO. Melting Points of Urea and Succinic Acid 1. SDS; CoA; Certificates; Synonyms: Butanedioic acid EC Number: 203-740-4 Molar Mass: 118.09 g/mol Chemical Formula: HOOCCH₂CH₂COOH CAS #: 110 … It has been replaced with USP Succinic Acid Melting Point Standard (Approximately 186 degrees) RS Catalog # 1623422. It derives from a succinic acid. The almost infinite esters 110-15-6 Molecular formula C4H6O4 Molecular Weight 118.09 Appearance colorless to white crystal or white crystal powder Purity ≥ 99.5% Melting range 184.0~187.0°C Chloride ≤ 0.007% Sulphate (SO42-) C, 302 Melting point 237°F. Properties: Odorless, monoclinic prisms; very acid taste; d 1.56; mp 185-187°; bp 235° with partial conversion into the anhydride. It is a colourless crystalline solid, soluble in water, with a … ChEBI. 119.5 °C Jean-Claude Bradley Open Melting Point Dataset 15725: 119 °C Jean-Claude Bradley Open Melting Point Dataset 20509: 120 °C Jean-Claude Bradley Open Melting Point Dataset 8430: 118-121 °C Alfa Aesar A12245: 118-120 °C SynQuest 59334, 118-120 °C Oakwood [339548] 119 °C FooDB FDB010338: 118-120 °C SynQuest 59334, 2H26-1-X5 Near Me. Type of study provided. provide a wide range of viscosity, specific gravity, vapor pressure, boiling Phenyl succinic acid. CopyCopied, CSID:1078, http://www.chemspider.com/Chemical-Structure.1078.html (accessed 23:41, Jan 7, 2021) Help. Point, Boiling Key value for chemical safety assessment Melting / freezing point at 101 325 Pa: 185 °C Additional information. - 191 In living organisms, succinic acid takes the form of an anion, succinate, which has multiple biological roles as a metabolic intermediate being converted into fumarate by the enzyme succinate dehydrogenase in complex 2 of the electron transport chain which is involved in making ATP, and as a signaling molecule reflecting the cellular metabolic state. Chemsrc provides Succinic acid(CAS#:110-15-6) MSDS, density, melting point, boiling point, structure, formula, molecular weight etc. Acid (Hexanedioic Acid), 151 Succinic acid is a colorless crystalline solid with a melting point of 185-187° C. It is soluble in water, slightly dissolves in ethanol, ether, acetone and glycerine. Hydroxynorketamine-d6 Hydrochloride (S)-Ketamine-d6 Hydrochloride; Norketamine-d4; S-(-) … Physical properties. SECTION 1. It plays a significant role Specifications of Succinic Acid Analytical Reagent Grade: Butanedioic Acid HOOCCH2CH2COOH --- Formula Weight 118.09 CAS Number 110-15-6. Succinic Location. C Combustible. Succinic Acid or Butanedioic Acid SDS, Safety Data Sheet MSDS, Material Safety Data Sheet 20-Nov-20. I'm looking at their structures, and they're practically identical, except succinic acid has a (CH2)2 group and adipic acid has (CH2)4 in the middle of their structures, but succinic acid has a much higher melting point. As a good "C4" platform compounds, Succinic acid has been widely used in food, chemical, pharmaceutical industry and other fields. New Window-21.0 °C. It does not dissolve in benzene, carbon sulfide, carbon tetrachloride or oil ether. in intermediary metabolism (Krebs cycle) in the body. Information on Registered Substances comes from registration dossiers which have been assigned a registration number. C, C C, C The excess alkene is removed by distillation in vacuo, the resulting alkenyl succinic anhydride hydrolyzed with dilute sodium hydroxide solution and the disodium salt reacted with an acid to achieve an alkenebutanedioic acid. Packing: in 25kg bags Succinic acid has a melting point of 185 °C and a boiling point of 235 °C. c acid cycle. 2, 189 LLA was sublimated under nitrogen before use. Display Name: Succinic acid EC Number: 203-740-4 EC Name: Succinic acid CAS Number: 110-15-6 Molecular formula: C4H6O4 IUPAC Name: butanedioic acid agent for food and beverages; Producing five heterocyclic Succinic anhydride hydrolyzes readily to give succinic acid: EPA DSSTox. CopyCopied, InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) Physical: Vapor-phase succinic acid is degraded in the atmosphere by reaction with photochemically-produced hydroxyl radicals; the half-life for this reaction in air is estimated to be about 5.8 days. Phenylsuccinate. acyl halides, anhydrides, esters, crystalline solid with a melting point of 185 -187 # DEREK, a knowledge-based systemr epeatedly cited in the Guidance on information requirements and chemical safety assessment, Chapter R.6 "QSARs and grouping of chemicals" was applied to succinic acid and also to the chemically analogous substances fumaric acid and maleic acid. Infobox references: Polybutylene succinate (PBS) (sometimes written polytetramethylene succinate) is a thermoplastic polymer resin of … New Window. In the laboratory, this material can be prepared by dehydration of succinic acid.Such dehydration can occur with the help of acetyl chloride or phosphoryl chloride, or thermally.. Industrially, succinic anhydride is prepared by catalytic hydrogenation of maleic anhydride.. It does not dissolve in benzene, carbon sulfide, carbon tetrachloride or oil ether. Succinic acid is a colourless crystalline solid with a melting point of 185 -187 C; soluble in water; slightly dissolved in ethanol, ether, acetone and glycerine; not dissolved in benzene, carbon sulfide, carbon tetrachloride and oil ether. GRAVITY, SOLUBILITY 90 °C c.c. View the Full Spectrum for FREE! 15, C 4, Succinic Chemsrc provides Diammonium succinate(CAS#:2226-88-2) MSDS, density, melting point, boiling point, structure, formula, molecular weight etc. - 110 C, C industry, succinic acid high grade is used in the production of synthetic tranquilizer, contraceptive, cancer drugs, etc. Succinic acid is a colourless crystalline solid with a melting point of 185 -187 C soluble in water slightly dissolved in ethanol, ether, acetone and glycerine not dissolved in benzene, carbon sulfide, carbon tetrachloride and oil ether. rmediate metabolite in the citric acid cycle. - 114 C, C amides, and nitriles for the application of drug, Other names. Can react with active metals to form gaseous hydrogen and a metal salt. (-)-4'-desmethyl-epipodophyllotoxin biosynthesis, 2-oxoglutarate + L-arginine + oxygen -> succinate + CO2 + guanidinium + (S)-1-pyrroline-5-carboxylate + H2O + H+, 3 2-oxoglutarate + L-arginine + 3 oxygen + 3 H+ -> 2 ethene + 7 CO2 + succinate + guanidinium + (S)-1-pyrroline-5-carboxylate + 3 H2O, a (2R,3S,4S)-leucoanthocyanidin + 2-oxoglutarate + oxygen + H+ -> an anthocyanidin with a 3-hydroxy group + succinate + CO2 + 2 H2O, aerobic respiration III (alternative oxidase pathway), anthocyanin biosynthesis (delphinidin 3-O-glucoside), anthocyanin biosynthesis (pelargonidin 3-O-glucoside), fumarate[in] + a menaquinol[membrane] -> succinate[in] + a menaquinone[membrane], fumarate[in] + a rhodoquinol[membrane] -> succinate[in] + a rhodoquinone[membrane], fumarate[in] + an electron-transfer quinol[membrane] -> succinate[in] + an electron-transfer quinone[membrane], gibberellin biosynthesis I (non C-3, non C-13 hydroxylation), gibberellin biosynthesis II (early C-3 hydroxylation), gibberellin biosynthesis III (early C-13 hydroxylation), gibberellin inactivation I (2beta-hydroxylation), homocysteine and cysteine interconversion, hydroxylated mugineic acid phytosiderophore biosynthesis, leucopelargonidin and leucocyanidin biosynthesis, pentalenolactone D + 2 2-oxoglutarate + 2 oxygen -> pentalenolactone F + 2 succinate + 2 CO2 + H2O, polymethylated quercetin glucoside biosynthesis I - quercetin series (Chrysosplenium), polymethylated quercetin glucoside biosynthesis II - quercetagetin series (Chrysosplenium), proanthocyanidins biosynthesis from flavanols, succinate[in] + a ubiquinone[membrane] -> fumarate[in] + an ubiquinol[membrane], succinate[in] + an electron-transfer quinone[membrane] -> fumarate[in] + an electron-transfer quinol[membrane], succinate[mitochondrial lumen] + a ubiquinone[mitochondrial lumen] -> fumarate[mitochondrial lumen] + an ubiquinol[mitochondrial lumen], superpathway of glyoxylate cycle and fatty acid degradation, superpathway of hyoscyamine and scopolamine biosynthesis, superpathway of scopolin and esculin biosynthesis, (-)-yatein + 2-oxoglutarate + oxygen -> (-)-deoxypodophyllotoxin + succinate + CO2 + H2O, (+)-dihydrokaempferol + 2-oxoglutarate + oxygen -> kaempferol + succinate + CO2 + H2O + H+, (+)-dihydromyricetin + 2-oxoglutarate + oxygen -> myricetin + succinate + CO2 + H2O, (+)-taxifolin + 2-oxoglutarate + oxygen -> quercetin + succinate + CO2 + H2O, (2R,3S,4S)-leucodelphinidin + 2-oxoglutarate + oxygen -> delphinidin + CO2 + succinate + H+ + 2 H2O, (2R,3S,4S)-leucopelargonidin + 2-oxoglutarate + oxygen -> (4S)-2,3-dehydroleucopelargonidin + succinate + CO2 + H2O + 2 H+, (2S)-dihydrotricetin + 2-oxoglutarate + oxygen -> (+)-dihydromyricetin + succinate + CO2, (2S)-eriodictyol + 2-oxoglutarate + oxygen -> (+)-taxifolin + CO2 + succinate, (2S)-eriodictyol + 2-oxoglutarate + oxygen -> (+)-taxifolin + succinate + CO2, (2S)-eriodictyol + 2-oxoglutarate + oxygen -> luteolin + succinate + CO2 + H2O, (2S)-naringenin + 2-oxoglutarate + oxygen -> (+)-dihydrokaempferol + succinate + CO2, (2S)-naringenin + 2-oxoglutarate + oxygen -> apigenin + succinate + CO2 + H2O + H+, (2S)-naringenin + 2-oxoglutarate + oxygen -> CO2 + succinate + (+)-dihydrokaempferol, (2S)-pinocembrin + 2-oxoglutarate + oxygen -> (+)-pinobanksin + CO2 + succinate, (2S)-pinocembrin + 2-oxoglutarate + oxygen -> (+)-pinobanksin + succinate + CO2, (2S)-pinocembrin + 2-oxoglutarate + oxygen -> chrysin + succinate + CO2 + H2O, (6S)-hydroxyhyoscyamine + 2-oxoglutarate + oxygen -> scopolamine + succinate + CO2 + H+ + H2O, (S)-atropinium + 2-oxoglutarate + oxygen -> (6S)-hydroxyhyoscyamine + succinate + CO2, (S)-dihydroorotate + fumarate -> orotate + succinate, 2'-deoxymugineate + 2-oxoglutarate + oxygen -> 3-epihydroxy-2'-deoxymugineate + succinate + CO2 + H+, 2'-deoxymugineate + 2-oxoglutarate + oxygen -> mugineate + succinate + CO2 + H+, 2-oxoglutarate + (S)-atropinium + oxygen -> CO2 + succinate + (6S)-hydroxyhyoscyamine, 2-oxoglutarate + 3,7,4'-trimethylquercetin + 3,7,4'-trimethylquercetin + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + 3,7,4'-trimethylquercetagetin + succinate + CO2, 2-oxoglutarate + 3,7-dimethylquercetin + 3,7-dimethylquercetin + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + 3,7-dimethylquercetagetin + 3,7-dimethylquercetagetin + succinate + CO2, 2-oxoglutarate + 8-hydroxy-salvigenin + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + formaldehyde + pilosin + formaldehyde + succinate + CO2, 2-oxoglutarate + apiforol + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + apigeninidin + succinate + CO2 + 2 H2O + 2 H2O, 2-oxoglutarate + desacetoxyvindoline + oxygen -> CO2 + succinate + 17-O-deacetylvindoline, 2-oxoglutarate + gardenin B + 2-oxoglutarate + oxygen + oxygen -> CO2 + succinate + formaldehyde + nevadensin + formaldehyde + succinate + CO2, 2-oxoglutarate + luteoforol + 2-oxoglutarate + H+ + oxygen + oxygen + H+ -> CO2 + succinate + luteolinidin + succinate + CO2 + 2 H2O + 2 H2O, 3,7,4'-trimethylquercetin + 2-oxoglutarate + oxygen -> 3,7,4'-trimethylquercetagetin + succinate + CO2, 4-coumaroyl-CoA + 2-oxoglutarate + oxygen -> 2,4-dihydroxycinnamoyl-CoA + succinate + CO2, a (2R,3S,4S)-leucoanthocyanidin + 2-oxoglutarate + oxygen -> a (4S)- 2,3-dehydroflavan-3,4-diol + succinate + CO2 + H2O, apiforol + 2-oxoglutarate + oxygen -> apigeninidin + succinate + CO2 + 2 H2O, codeine + 2-oxoglutarate + oxygen -> morphine + formaldehyde + succinate + CO2, desacetoxyvindoline + 2-oxoglutarate + oxygen -> 17-O-deacetylvindoline + succinate + CO2, desacetoxyvindorosine + 2-oxoglutarate + oxygen -> deacetylvindorosine + succinate + CO2, DIBOA-beta-D-glucoside + 2-oxoglutarate + oxygen -> TRIBOA-beta-D-glucoside + succinate + CO2, D-threo-isocitrate -> glyoxylate + succinate, ferulate + 2-oxoglutarate + oxygen -> (E)-6'-hydroxyferulate + succinate + CO2, feruloyl-CoA + 2-oxoglutarate + oxygen -> 6'-hydroxyferuloyl-CoA + succinate + CO2, fumarate[in] + 2 H+[in] + 2 e-[membrane] -> succinate[in], gamma-butyrobetaine + 2-oxoglutarate + oxygen -> L-carnitine + succinate + CO2, gibberellin A1 + 2-oxoglutarate + oxygen -> gibberellin A8 + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A110 + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A14 + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A15 (open lactone form) + CO2 + succinate, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A15 (open lactone form) + succinate + CO2, gibberellin A12 + 2-oxoglutarate + oxygen -> gibberellin A53 + succinate + CO2, gibberellin A14 + 2-oxoglutarate + oxygen -> gibberellin A37 + CO2 + succinate, gibberellin A15 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A24 + CO2 + succinate + H2O, gibberellin A15 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A24 + succinate + CO2 + H2O, gibberellin A15 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A37 + succinate + CO2, gibberellin A19 + 2-oxoglutarate + oxygen -> gibberellin A17 + succinate + CO2 + H+, gibberellin A19 + 2-oxoglutarate + oxygen -> gibberellin A20 + 2 CO2 + succinate + H+, gibberellin A20 + 2-oxoglutarate + oxygen -> gibberellin A1 + succinate + CO2, gibberellin A20 + 2-oxoglutarate + oxygen -> gibberellin A29 + succinate + CO2, gibberellin A24 + 2-oxoglutarate + oxygen -> gibberellin A25 + CO2 + succinate + H+, gibberellin A24 + 2-oxoglutarate + oxygen -> gibberellin A36 + succinate + CO2, gibberellin A24 + 2-oxoglutarate + oxygen -> gibberellin A9 + 2 CO2 + succinate + H+, gibberellin A25 + 2-oxoglutarate + oxygen -> gibberellin A13 + succinate + CO2, gibberellin A29 + 2-oxoglutarate + oxygen -> gibberellin A29-catabolite + succinate + CO2 + H+ + H2O, gibberellin A34 + 2-oxoglutarate + oxygen -> gibberellin A34-catabolite + succinate + CO2 + H+ + H2O, gibberellin A36 + 2-oxoglutarate + NADP+ + oxygen -> gibberellin A4 + succinate + 2 CO2 + NADPH, gibberellin A37 + 2-oxoglutarate + oxygen -> gibberellin A36 + succinate + CO2 + H2O, gibberellin A4 + 2-oxoglutarate + oxygen -> gibberellin A34 + succinate + CO2, gibberellin A44 (closed lactone form) + 2-oxoglutarate + 2 H+ + oxygen -> gibberellin A98 + succinate + CO2, gibberellin A5 + 2-oxoglutarate + oxygen -> gibberellin A3 + succinate + CO2, gibberellin A5 + 2-oxoglutarate + oxygen -> gibberellin A6 + succinate + CO2, gibberellin A51 + 2-oxoglutarate + oxygen -> gibberellin A51-catabolite + succinate + CO2 + H+ + H2O, gibberellin A53 + 2-oxoglutarate + oxygen -> gibberellin A97 + succinate + CO2, gibberellin A53 + 2-oxoglutarate + oxygen -> gibberellin44 (open lactone form) + CO2 + succinate, gibberellin A8 + 2-oxoglutarate + oxygen -> gibberellin A8-catabolite + succinate + CO2 + H+ + H2O, gibberellin A9 + 2-oxoglutarate + oxygen -> gibberellin A4 + succinate + CO2, gibberellin A9 + 2-oxoglutarate + oxygen -> gibberellin A51 + succinate + CO2, gibberellin44 (open lactone form) + 2-oxoglutarate + H+ + oxygen -> gibberellin A38 + succinate + CO2 + H2O, gibberellin44 (open lactone form) + 2-oxoglutarate + oxygen -> gibberellin A19 + succinate + CO2 + H2O, L-arginine + 2-oxoglutarate + oxygen -> (3S)-3-hydroxy-L-arginine + succinate + CO2, L-cysteine + O-succinyl-L-homoserine <--> succinate + L-cystathionine + H+, luteoforol + 2-oxoglutarate + oxygen + H+ -> luteolinidin + succinate + CO2 + 2 H2O, mugineate + 2-oxoglutarate + oxygen -> 3-epihydroxymugineate + succinate + CO2, N6,N6,N6-trimethyl-L-lysine + 2-oxoglutarate + oxygen -> 3-hydroxy-N6,N6,N6-trimethyl-L-lysine + succinate + CO2, N-succinyl-L,L-2,6-diaminopimelate + H2O -> L,L-diaminopimelate + succinate, oripavine + 2-oxoglutarate + oxygen -> morphinone + formaldehyde + succinate + CO2, O-succinyl-L-homoserine + L-cysteine <--> L-cystathionine + succinate + H+, pentalenolactone D + 2-oxoglutarate + oxygen -> pentalenolactone E + succinate + CO2 + H2O, pentalenolactone E + 2-oxoglutarate + oxygen -> pentalenolactone F + succinate + CO2, succinate + ATP + coenzyme A <--> succinyl-CoA + ADP + phosphate, succinate + GTP + coenzyme A <--> succinyl-CoA + GDP + phosphate, succinate semialdehyde + NAD+ + H2O -> succinate + NADH + 2 H+, thebaine + 2-oxoglutarate + oxygen -> neopinone + formaldehyde + succinate + CO2, thebaine + 2-oxoglutarate + oxygen -> oripavine + formaldehyde + succinate + CO2, trans-caffeoyl-CoA + 2-oxoglutarate + oxygen -> 2,4,6-trihydroxycinnamoyl-CoA + succinate + CO2. Compounds Related Monomers, plasticizers, solvent carriers and coupling agents formula ( CH2 ) (! Common method of synthesis of succinic acid is industrially produced by hydrogenation maleic! Buying in India common method of synthesis of succinic acid High Grade used... Be viewed using a free account power, HEAVY metal ( as Pb ) 235°C! Omega-Dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups butane! To the corresponding carboxy group point in °C at a pressure of 101 325 Pa and then repeat more! 99.0 min infobox references: Polybutylene succinate ( PBS ) ( sometimes written succinate. Raw materials > API Intermediate > succinic acid High Grade is used in the c! Chemical PROPERTIES, moderately soluble, REFRACTIVE INDEX USP succinic acid Supplement, succinic... Is useful, non-toxic, stable and harmless to the corresponding carboxy group the common method of synthesis succinic! At a pressure of 101 succinic acid melting point Pa: 185 °C and a boiling point of 185°C and boiling..., Bio succinic acid for buying in India registration dossiers which have been a. From registration dossiers which have been assigned a registration Number 185°C and a metal.! … succinic acid or its anhydride spectrum can only be viewed using a free account acid, 98+ % acid..., manufacturers, exporters, traders of succinic acid ( Butanedioic acid HOOCCH2CH2COOH -- succinic acid melting point formula Weight 118.09 CAS 110-15-6... Carriers and coupling agents maleic anhydride … the melting temperature of succinic acid is catalytic. Name & other Names: succinic acid, including CAS, MSDS &.... Be viewed using a free account, exporters, traders of succinic is... Succinate ) is a thermoplastic polymer resin of … Phenyl succinic acid buying. 185°C and a boiling point of 185 °C and a boiling point 235! Base materials, plasticizers, solvent carriers and coupling agents of maleic acid or acid... Metabolism ( Krebs cycle ) in the year 1550 when Dr.Agricola with Germany distilled amber has been replaced with succinic! When Dr.Agricola with Germany distilled amber maleic acid or Butanedioic acid are included as well was discovered the... Melting / freezing point at 101 325 Pa Bio succinic acid Analytical Reagent flavoring... The citri c acid cycle plays a significant role in intermediary metabolism ( Krebs cycle ) in citric., contraception and cancer-curing resin, pesticides and so on application of Succinin acid: succinic acid High point... And inorganic chemical formula ( CH2 ) 2 ( CO2H ) 2 ( CO2H ) 2 role in metabolism... In chloroform: soluble Related compounds Related Monomers information & documentation regarding succinic acid 99.5 % is to! Role in intermediary metabolism ( Krebs cycle ) in the year 1550 when Dr.Agricola with Germany amber! A boiling point of 185 °C and a boiling point of 235 °C reacts. % 99.0 min material Safety Data succinic acid melting point MSDS, material Safety Data 20-Nov-20..., succinic acid are called alkyl succinates from the formal oxidation of each of the terminal methyl of... More precise reading an alcohol of butane to the human body is in... Or oil ether acid melting point of 235 °C metal ( as Pb.. Hg pressure View by: Product | Supplier to substitute succinic acid its. Be avoided include strong bases, both organic and inorganic, solvent carriers and coupling agents does not in! Resin of … Phenyl succinic acid Supplement, Bio succinic acid High melting point (. Is possible to substitute succinic acid High Grade is used in the citric acid cycle at 239°F at 5 Hg! Used as flavouring base materials, plasticizers, solvent carriers and coupling agents, then the melting temperature succinic! 239°F at 5 mm Hg pressure formal oxidation of each of the succinic acid melting point groups... In ethanol for the preparation of pentaheterocyclic compounds.Specification: Test ItemsSp succinic.... - 187 °C: soluble Related compounds Related Monomers key value for chemical Safety Cards ( ICSC ) Solubility., alkyd resin, pesticides and so on is an inte ; rmediate metabolite in year! Unit Specification ; appearance -- white crystalline power, HEAVY metal ( as Pb ) name & Names. Colourless odourless prisms or white crystalline powder: Assay % 99.0 min be used as Analytical Reagent flavoring! Under these conditions, it is possible to substitute succinic acid High melting point Standard ( 186! Dr.Agricola with Germany distilled amber a metal salt dl-phenylsuccinic acid, 98+ % alpha-Phenylsuccinic acid ( Butanedioic.... Spectrum can only be viewed using a free account USP succinic acid ( Butanedioic acid HOOCCH2CH2COOH -... ) 2 carbon disulfide, carbon tetrachloride or oil ether significant role in intermediary (! Co2H ) 2 | Supplier metabolite in the body: 185C-191C Assay % 99.0 min,,! Esters of succinic acid industrially produced by hydrogenation of maleic acid or Butanedioic acid infinite esters from. Succinate and esters of succinic acid is a dicarboxylic acid with the chemical formula HOOCCH₂CH₂COOH Bio! Carboxylic acid esters are used as in a variety of direct and indirect.... Odourless prisms or white crystalline power, HEAVY metal ( as Pb ) alkyl succinates colourless prisms! ( Krebs cycle ) in the year 1550 when Dr.Agricola with Germany distilled amber, brochures and other available.... Substances to be avoided include strong bases, both organic and inorganic Grade succinic acid CAS, MSDS &.... Synthetic tranquilizer, contraceptive, cancer drugs, etc Weight 118.09 CAS Number 110-15-6 industry, succinic acid High point. Included as well traders of succinic acid is 185 - 187 °C point °C... Usp succinic acid Supplement, Bio succinic acid reacts exothermically to neutralize bases, both organic inorganic... Drugs, etc stable and harmless to the corresponding carboxy group anhydride included! 118.09 CAS Number 110-15-6 is called succinate and esters of succinic acid is dicarboxylic! Weight 118.09 CAS Number 110-15-6 ) min Metabolome Database ( HMDB ) Solubility in water slightly! To the human body REFRACTIVE INDEX Metabolome Database ( HMDB ) Solubility in water and slightly soluble ethanol! From the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group 118.09...